3-dehydro-2-deoxy-D-gluconic acid


InChI: InChI=1/C6H10O6/c7-2-4(9)6(12)3(8)1-5(10)11/h4,6-7,9,12H,1-2H2,(H,10,11)/t4-,6+/m1/s1

InChIKey: InChIKey=CNLFCQPCBQQMHK-XINAWCOVBX
SMILES: OC[[email protected]@H](O)[[email protected]@H](O)C(=O)CC(O)=O

Names:
    3-Dehydro-2-deoxy-D-gluconate
    3-dehydro-2-deoxy-D-gluconate
    3-Dehydro-2-deoxy-D-gluconate
    3-dehydro-2-deoxy-D-gluconic acid

Registries:
    PubChem CID 627
    ChEBI 16622
    Kegg C03926
    PubChem ID 6654