RAM

Molecular Formula: C6H12O5


InChI: InChI=1/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3-,4+,5+,6+/m0/s1

InChIKey: InChIKey=SHZGCJCMOBCMKK-HGVZOGFYBO
SMILES: C[[email protected]@H]1O[[email protected]@H](O)[[email protected]](O)[[email protected]](O)[[email protected]]1O

Names:
    alpha-L-Mannomethylose
    alpha-L-Rhamnose
    alpha-L-rhamnose
    alpha-6-Deoxy-L-mannose
    RAM
    α-L-Rha
    (2R,3R,4R,5R,6S)-6-methyloxane-2,3,4,5-tetrol

Registries:
    PubChem CID 439710
    ChEBI 27907
    Kegg C02476
    PubChem ID 11532582
    PubChem ID 5491