alpha-D-lyxose

Molecular Formula: C5H10O5


InChI: InChI=1/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4+,5+/m1/s1

InChIKey: InChIKey=SRBFZHDQGSBBOR-STGXQOJABA
SMILES: O[[email protected]@H]1CO[[email protected]](O)[[email protected]@H](O)[[email protected]]1O

Names:
    alpha-D-Lyxose
    alpha-D-lyxose
    α-D-Lyx
    (2S,3S,4S,5R)-oxane-2,3,4,5-tetrol

Registries:
    PubChem CID 439678
    ChEBI 28543
    Kegg C02204
    PubChem ID 15265007
    PubChem ID 5272