D-cysteinium

Molecular Formula: C3H8NO2S+


InChI: InChI=1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/p+1/t2-/m1/s1/fC3H8NO2S/h4-5H/q+1

InChIKey: InChIKey=XUJNEKJLAYXESH-FEJREYHEDJ
SMILES: [NH3+][[email protected]](CS)C(O)=O

Names:
    CHEBI:32451
    D-cysteine cation
    D-cysteinium
    (1S)-1-carboxy-2-mercaptoethanaminium
    (1S)-1-carboxy-2-sulfanylethanaminium
    [(1R)-1-carboxy-2-sulfanyl-ethyl]azanium

Registries:
    PubChem CID 5460966
    ChEBI 32451
    PubChem ID 8147754