L-Malic acid


InChI: InChI=1/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m0/s1

InChIKey: InChIKey=BJEPYKJPYRNKOW-MRIHDYNCBL
SMILES: O[[email protected]@H](CC([O-])=O)C([O-])=O

Names:
    L-Apple acid
    L-Malate
    L-malate
    L-Malic acid
    L-2-Hydroxybutanedioic acid
    (S)-Malate
    (S)-malate
    (S)-malate(2-)

Registries:
    PubChem CID 222656
    ChEBI 15589
    Kegg C00149
    PubChem ID 3449