
Molecular Formula: C9H13N

InChI: InChI=1/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/t8-/m1/s1

SMILES: C[[email protected]@H](N)Cc1ccccc1

CAS number 156-34-3


    PubChem CID 32893
    Beilstein =2432739
    CAS 156-34-3 (from NIST)
    ChEBI 35339
    Gmelin 1125855
    PubChem ID 11533695