queuine


InChI: InChI=1/C12H15N5O3/c13-12-16-10-8(11(20)17-12)5(4-15-10)3-14-6-1-2-7(18)9(6)19/h1-2,4,6-7,9,14,18-19H,3H2,(H4,13,15,16,17,20)/t6-,7-,9+/m0/s1

InChIKey: InChIKey=WYROLENTHWJFLR-ACLDMZEEBO
SMILES: NC1=NC2=C(C(=O)N1)C(CN[[email protected]]3C=C[[email protected]](O)[[email protected]@H]3O)=CN2

Names:
    Queuine
    queuine
    Queuine
    queuine
    7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine

Registries:
    PubChem CID 114881
    ChEBI 17433
    Kegg C01449
    PubChem ID 4626