(2S)-2-[[(1R)-1-carboxylatoethyl]amino]propanoate

Molecular Formula: C6H9NO4-2


InChI: InChI=1/C6H11NO4/c1-3(5(8)9)7-4(2)6(10)11/h3-4,7H,1-2H3,(H,8,9)(H,10,11)/p-2/t3-,4+/fC6H9NO4/q-2

InChIKey: InChIKey=FIOHTMQGSFVHEZ-IJAVJBMJDY
SMILES: C[[email protected]](N[[email protected]](C)C([O-])=O)C([O-])=O

Names:
    CHEBI:37031
    meso-2,2'-iminodipropanoate
    meso-2,2'-iminodipropanoate
    (2R,2'S)-2,2'-azanediyldipropanoate
    (2R,2'S)-2,2'-iminodipropanoate
    (2R,2'S)-2,2'-iminodipropanoate
    (2S)-2-[[(1R)-1-carboxylatoethyl]amino]propanoate

Registries:
    PubChem CID 11966262
    ChEBI 37031
    PubChem ID 17425324