Pretyrosine

Molecular Formula: C10H13NO5


InChI: InChI=1/C10H13NO5/c11-7(8(13)14)5-10(9(15)16)3-1-6(12)2-4-10/h1-4,6-7,12H,5,11H2,(H,13,14)(H,15,16)/t6?,7-,10?/m0/s1/f/h13,15H

InChIKey: InChIKey=MIEILDYWGANZNH-LRFMCVBMDV
SMILES: N[[email protected]@H](CC1(C=CC(O)C=C1)C(O)=O)C(O)=O

CAS number 53078-86-7

Names:
    alpha-Amino-1-carboxy-4-hydroxy-2,5-cyclohexadiene-1-propanoic acid
    L-Arogenate
    L-arogenate
    L-Arogenate
    L-Arogenic acid
    L-arogenic acid
    Pretyrosine
    1-[(2S)-2-amino-2-carboxy-ethyl]-4-hydroxy-cyclohexa-2,5-diene-1-carboxylic acid

Registries:
    PubChem CID 439319
    Beilstein =4458841
    CAS 53078-86-7 (from NIST)
    ChEBI 17530
    Kegg C00826
    PubChem ID 15900522
    PubChem ID 4084