cephalosporin C
MediLexicon cephalosporin C - Medical Dictionary Definition for Term 'cephalosporin C'
[1. an antibiotic with activity due to the 7-aminocephalosporanic acid portion of the cephalosporanic acid molecule; it is effective against gram-positive and gram-negative bacteria, but is less potent than cephalosporin N. Addition of side chains produced semisynthetic broad spectrum antibiotics with greater antibacterial activity than that of cephalosporin C; the antibiotic activity is due to interference with bacterial cell-wall synthesis.
InChI: InChI=1/C16H21N3O8S/c1-7(20)27-5-8-6-28-14-11(13(22)19(14)12(8)16(25)26)18-10(21)4-2-3-9(17)15(23)24/h9,11,14H,2-6,17H2,1H3,(H,18,21)(H,23,24)(H,25,26)/t9-,11-,14-/m1/s1
InChIKey: InChIKey=HOKIDJSKDBPKTQ-GLXFQSAKBW
SMILES: [H][C@]12SCC(COC(C)=O)=C(N1C(=O)[C@H]2NC(=O)CCC[C@@H](N)C(O)=O)C(O)=O
Names:
Cephalosporin C
cephalosporin C
Cephalosporin C
cephalosporin C
Registries:
PubChem CID 65536
ChEBI 15776
Kegg C00916
PubChem ID 4170
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|