L-xylo-Hexulonolactone

Molecular Formula: C6H8O6


InChI: InChI=1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,4-5,7-8,10H,1H2/t2-,4-,5+/m0/s1

InChIKey: InChIKey=PJBQWWHYTVYMLO-MDZRLIFHBR
SMILES: [H][[email protected]@]1(OC(=O)[[email protected]@H](O)C1=O)[[email protected]@H](O)CO

Names:
    C03289
    L-xylo-Hexulonolactone
    L-xylo-hex-3-ulonolactone
    L-xylo-hex-3-ulono-1,4-lactone
    (3S,5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-oxolane-2,4-dione

Registries:
    PubChem CID 5461125
    ChEBI 13068
    PubChem ID 6146