D-Leuzin

Molecular Formula: C6H13NO2


InChI: InChI=1/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1/f/h8H

InChIKey: InChIKey=ROHFNLRQFUQHCH-SCXRMYBXDF
SMILES: CC(C)C[[email protected]@H](N)C(O)=O

CAS number 328-38-1

Names:
    D-Leucine
    D-LEUCINE
    D-leucine
    D-Leuzin
    D-2-Amino-4-methylvaleric acid
    (R)-leucine
    (R)-(−)-leucine
    (2R)-2-amino-4-methylpentanoic acid
    (2R)-2-amino-4-methyl-pentanoic acid

Registries:
    PubChem CID 439524
    Beilstein =1721721
    CAS 328-38-1 (from NIST)
    ChEBI 28225
    chemPDB DLE
    Gmelin 82675
    Kegg C01570
    PubChem ID 10298361
    PubChem ID 4727