methyl (2E)-2-(3-oxo-1,4-diazepan-2-ylidene)acetate

Molecular Formula: C8H12N2O3


InChI: InChI=1/C8H12N2O3/c1-13-7(11)5-6-8(12)10-4-2-3-9-6/h5,9H,2-4H2,1H3,(H,10,12)/b6-5+/f/h10H

InChIKey: InChIKey=DPWDNHVRMFXKLM-BBTYNGBGDN
SMILES: COC(=O)C=C1C(=O)NCCCN1

Names:
    [email protected]
    methyl (2E)-2-(3-oxo-1,4-diazepan-2-ylidene)acetate

Registries:
    PubChem CID 5716758
    PubChem ID 3287178