(5R)-2-methyl-5-prop-1-en-2-yl-cyclohex-2-en-1-one

Molecular Formula: C10H14O


InChI: InChI=1/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3/t9-/m1/s1

InChIKey: InChIKey=ULDHMXUKGWMISQ-SECBINFHBY
SMILES: CC(=C)[[email protected]@H]1CC=C(C)C(=O)C1

Names:
    (R)-5-isopropenyl-2-methylcyclohex-2-en-1-one
    (-)-Carvone
    (-)-carvone
    (4R)-Carvone
    (5R)-2-methyl-5-prop-1-en-2-yl-cyclohex-2-en-1-one
    2-methyl-5-(1-methylethenyl)-2-cyclohexene-1-one

Registries:
    PubChem CID 439570
    ChEBI 15400
    Kegg C01767
    PubChem ID 10298380
    PubChem ID 4900
    UM-BBD c0627