p-Coumaryl alcohol 4-O-glucoside


InChI: InChI=1/C15H20O7/c16-7-1-2-9-3-5-10(6-4-9)21-15-14(20)13(19)12(18)11(8-17)22-15/h1-6,11-20H,7-8H2/t11-,12-,13+,14-,15-/m1/s1

InChIKey: InChIKey=CRVXJSNSTGEXDX-UXXRCYHCBP
SMILES: OCC=Cc1ccc(O[[email protected]@H]2O[[email protected]](CO)[[email protected]@H](O)[[email protected]](O)[[email protected]]2O)cc1

Names:
    p-Coumaryl alcohol 4-O-glucoside
    4-hydroxycinnamyl alcohol 4-beta-D-glucoside
    4-Hydroxycinnamyl alcohol 4-D-glucoside

Registries:
    PubChem CID 5280847
    ChEBI 27588
    Kegg C05855
    PubChem ID 8148