4-(beta-D-glucosyloxy)benzoic acid


InChI: InChI=1/C13H16O8/c14-5-8-9(15)10(16)11(17)13(21-8)20-7-3-1-6(2-4-7)12(18)19/h1-4,8-11,13-17H,5H2,(H,18,19)/t8-,9-,10+,11-,13-/m1/s1

InChIKey: InChIKey=XSSDYIMYZONMBL-BZNQNGANBZ
SMILES: OC[[email protected]]1O[[email protected]@H](OC2=CC=C(C=C2)C(O)=O)[[email protected]](O)[[email protected]@H](O)[[email protected]@H]1O

Names:
    4-(beta-D-Glucosyloxy)benzoate
    4-(beta-D-glucosyloxy)benzoic acid

Registries:
    PubChem CID 440186
    ChEBI 16741
    Kegg C03993
    PubChem ID 6706