Uridylic acid

[uridine esterified by phosphoric acid on one or more sugar hydroxyl groups; uMP is typically uridine 5'-monophosphate; 2' and 3' derivatives also occur; precursor for the biosynthesis of other pyrimidine nucleotides. Synonym: uMP synthase, uridine 5'-monophosphate. Uridylic acid synthase, a bifunctional enzyme that contains the activities of both orotate phosphoribosyltransferase and orotidine-5'-monophosphate decarboxylase; catalyses a key step in pyrimidine biosynthesis; a deficiency of this enzyme leads to orotic aciduria.

InChI: InChI=1/C9H13N2O9P/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,10,12,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1

InChIKey: InChIKey=DJJCXFVJDGTHFX-XVFCMESIBD
SMILES: O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(O)=O)N2C=CC(=O)NC2=O

Names:
    UMP
    Uridine monophosphate
    Uridine 5'-monophosphate
    uridylate
    Uridylic acid
    5'Uridylic acid

Registries:
    PubChem CID 6030
    ChEBI 16695
    Kegg C00105
    PubChem ID 3405