(2R)-2-phenyl-2,3-dihydro-4H-chromen-4-one

Molecular Formula: C15H12O2


InChI: InChI=1/C15H12O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-9,15H,10H2/t15-/m1/s1

InChIKey: InChIKey=ZONYXWQDUYMKFB-OAHLLOKOBV
SMILES: O=C1C[[email protected]@H](Oc2ccccc12)c3ccccc3

Names:
    CHEBI:36105
    (2R)-flavanone
    (2R)-2-phenylchroman-4-one
    (2R)-2-phenyl-2,3-dihydro-4H-chromen-4-one

Registries:
    PubChem CID 689010
    Beilstein =5379357
    Beilstein =85289
    ChEBI 36105
    PubChem ID 14718237