Leukotriene A4

Molecular Formula: C20H30O3


InChI: InChI=1/C20H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18-19(23-18)16-14-17-20(21)22/h6-7,9-13,15,18-19H,2-5,8,14,16-17H2,1H3,(H,21,22)/b7-6-,10-9-,12-11+,15-13+/t18-,19-/m0/s1/f/h21H

InChIKey: InChIKey=UFPQIRYSPUYQHK-WXRMEPPKDZ
SMILES: CCCCC\C=C/C\C=C/C=C/C=C/[[email protected]@H]1O[[email protected]]1CCCC(O)=O

CAS number 72059-45-1

Names:
    Leukotriene A4
    leukotriene A4
    Leukotriene A4
    leukotriene A4
    LTA4
    Oxiranebutanoic acid, 3-(1,3,5,8-tetradecatetraenyl)-, (2S-(2alpha,3beta(1E,3Z,5Z,8Z)))-
    (7E,9E,11Z,14Z)-(5S,6S)-5,6-Epoxyeicosa-7,9,11,14-tetraenoate
    (7E,9E,11Z,14Z)-(5S,6S)-5,6-Epoxyeicosa-7,9,11,14-tetraenoic acid
    (7E,9E,11Z,14Z)-(5S,6S)-5,6-Epoxyicosa-7,9,11,14-tetraenoate
    (7E,9E,11Z,14Z)-(5S,6S)-5,6-epoxyicosa-7,9,11,14-tetraenoate
    (7E,9E,11Z,14Z)-(5S,6S)-5,6-Epoxyicosa-7,9,11,14-tetraenoate
    4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoic acid
    5S,6S-epoxy-7E,9E,11Z,14Z-eicosatetraenoic acid

Registries:
    PubChem CID 5280383
    CAS 72059-45-1 (from NIST)
    ChEBI 15651
    Kegg C00909
    LIPID MAPS LMFA03020023
    PubChem ID 16892396
    PubChem ID 4164