beta-D-xylose

Molecular Formula: C5H10O5


InChI: InChI=1/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5-/m1/s1

InChIKey: InChIKey=SRBFZHDQGSBBOR-KKQCNMDGBB
SMILES: O[[email protected]@H]1CO[[email protected]@H](O)[[email protected]](O)[[email protected]]1O

Names:
    beta-D-Xylose
    beta-D-xylose
    (2R,3R,4S,5R)-oxane-2,3,4,5-tetrol

Registries:
    PubChem CID 125409
    ChEBI 28161
    Kegg C02096
    PubChem ID 10241336
    PubChem ID 5180