L-alpha-Methylbenzylamine

Molecular Formula: C8H11N


InChI: InChI=1/C8H11N/c1-7(9)8-5-3-2-4-6-8/h2-7H,9H2,1H3/t7-/m0/s1

InChIKey: InChIKey=RQEUFEKYXDPUSK-ZETCQYMHBE
SMILES: C[[email protected]](N)c1ccccc1

CAS number 2627-86-3

Names:
    CHEBI:35321
    L(−)-α-methylbenzylamine
    L(-)-alpha-Methylbenzylamine
    L-alpha-Methylbenzylamine
    L-α-methylbenzylamine
    L-(−)-α-phenylethylamine
    L-(−)-1-phenylethylamine
    L-(-)-alpha-Phenylethylamine
    L-(-)-1-Phenylethylamine
    (alphaS)-alpha-methylbenzenemethanamine
    (S)-alpha-Methylbenzenemethanamine
    (S)-α-methylbenzenemethanamine
    (S)-(−)-α-methylbenzylamine
    (S)-(-)-alpha-Methylbenzylamine
    (−)-α-phenethylamine
    (αS)-α-methylbenzenemethanamine
    (-)-alpha-Phenethylamine
    (1S)-1-phenylethanamine

Registries:
    PubChem CID 75818
    Beilstein =2204907
    CAS 2627-86-3 (from NIST)
    ChEBI 35321
    Gmelin 2893
    PubChem ID 10318886