D-valine anion

Molecular Formula: C5H10NO2-


InChI: InChI=1/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/p-1/t4-/m1/s1/fC5H10NO2/q-1

InChIKey: InChIKey=KZSNJWFQEVHDMF-YBXWEPBBDZ
SMILES: CC(C)[[email protected]@H](N)C([O-])=O

Names:
    CHEBI:32855
    D-valinate
    D-valine anion
    (2R)-2-amino-3-methylbutanoate
    (2R)-2-amino-3-methyl-butanoate

Registries:
    PubChem CID 5460780
    ChEBI 32855
    PubChem ID 8147407