Thiomethyladenosine


InChI: InChI=1/C11H15N5O3S/c1-20-2-5-7(17)8(18)11(19-5)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7-,8-,11-/m1/s1

InChIKey: InChIKey=WUUGFSXJNOTRMR-IOSLPCCCBD
SMILES: CSC[[email protected]]1O[[email protected]]([[email protected]](O)[[email protected]@H]1O)N2C=NC3=C2N=CN=C3N

Names:
    Methylthioadenosine
    MTA
    S-Methyl-5'-thioadenosine
    S-methyl-5'-thioadenosine
    Thiomethyladenosine
    5'-Deoxy-5'-(methylthio)adenosine
    5'-Methylthioadenosine
    5'-S-methyl-5'-thioadenosine
    5-Methylthioadenosine
    9-(5-S-methyl-5-thio-β-D-ribofuranosyl)-9H-purin-6-amine

Registries:
    PubChem CID 439176
    ChEBI 17509
    Kegg C00170
    PubChem ID 3470