MENTHOL

PubChem Notes:

Menthol An alcohol produced from mint oils or prepared synthetically.

Molecular Formula: C10H20O


InChI: InChI=1/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1

InChIKey: InChIKey=NOOLISFMXDJSKH-KXUCPTDWBX
SMILES: CC(C)[[email protected]@H]1CC[[email protected]@H](C)C[[email protected]]1O

Names:
    Cyclohexanol, 5-methyl-2- (1-methylethyl)-, [1R-(1.alpha.,2.beta.,5.alpha.)]-
    hexahydrothymol
    l-Menthol
    L-Menthol
    l-(-)-Menthol
    Menthol, (1R,3R, 4S)-(-)-
    MENTHOL
    NSC62788
    U.S.P. Menthol
    (R)-(-)-Menthol
    (-)-menthol
    (-)-Menthol
    (-)-menthol
    (-)-Menthol
    (-)-menthol
    (1alpha,2beta,5alpha)-5-methyl-2(1-methylethyl)cyclohexanol
    (1R,2S,5R)-5-methyl-2-propan-2-yl-cyclohexan-1-ol
    2216-51-5

Registries:
    PubChem CID 16666
    ChEBI 15409
    Kegg C00400
    PubChem ID 109787
    PubChem ID 3690