PYROGLUTAMIC ACID

Molecular Formula: C5H7NO3


InChI: InChI=1/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m0/s1/f/h6,8H

InChIKey: InChIKey=ODHCTXKNWHHXJC-NEWVVPMODF
SMILES: [H][[email protected]]1(CCC(=O)N1)C(O)=O

CAS number 98-79-3

Names:
    L-Pyroglutamic acid
    L-5-Pyrrolidone-2-carboxylic acid
    pidolic acid
    PYROGLUTAMIC ACID
    (S)-pyroglutamic acid
    (S)-(−)-2-pyrrolidone-5-carboxylic acid
    (−)-2-pyrrolidone-5-carboxylic acid
    (2S)-5-oxopyrrolidine-2-carboxylic acid
    5-Oxo-L-proline
    5-oxo-L-proline
    5-Oxo-L-proline
    5-oxo-L-proline

Registries:
    PubChem CID 7405
    Beilstein =5251861
    Beilstein =82132
    CAS 98-79-3 (from NIST)
    ChEBI 18183
    chemPDB PCA
    Gmelin 1125330
    Kegg C02238
    PubChem ID 14747635
    PubChem ID 5302