boschniakine

Molecular Formula: C10H11NO


InChI: InChI=1/C10H11NO/c1-7-2-3-9-8(6-12)4-11-5-10(7)9/h4-7H,2-3H2,1H3/t7-/m1/s1

InChIKey: InChIKey=OPRAONAUWNNOOV-SSDOTTSWBL
SMILES: C[[email protected]@H]1CCC2=C(C=O)C=NC=C12

CAS number 18070-40-1

Names:
    Boschniakine
    boschniakine
    C09915
    (R)-6,7-dihydro-7-methyl-5H-2-pyrindinecarboxaldehyde
    (R)-6,7-dihydro-7-methyl-5H-2-pyrindine-4-carboxaldehyde
    (9R)-9-methyl-3-azabicyclo[4.3.0]nona-2,4,10-triene-5-carbaldehyde
    18070-40-1

Registries:
    PubChem CID 442507
    Beilstein =3934
    CAS 18070-40-1 (from NIST)
    ChEBI 3157
    Kegg C09915
    PubChem ID 12101