D-galacturonic acid


InChI: InChI=1/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4+,5-/m0/s1

InChIKey: InChIKey=IAJILQKETJEXLJ-RSJOWCBRBL
SMILES: [H][[email protected]](O)(C=O)[[email protected]@]([H])(O)[[email protected]@]([H])(O)[[email protected]]([H])(O)C(O)=O

CAS number 685-73-4

Names:
    D-Galacturonate
    D-Galacturonic acid
    D-galacturonic acid

Registries:
    PubChem CID 439215
    CAS 685-73-4 (from NIST)
    ChEBI 18024
    Kegg C00333
    PubChem ID 3627