Abscisic acid
Abscisic acid - definition from Biology-Online.org
[(Science: biochemistry) a lipid hormone that inhibits cell growth in plants, it is associated with fruit drop, leaf death and seed dormancy. It is synthesised in the plastids from carotenoids. this hormone helps plants deal with water loss, and its effects can be reversed with gibberellins. Partly responsible for leaf Abscission in aging or diseased plants and also responsible for promoting dormancy in buds and seeds, abscisic acid is a plant growth substance which is also involved in the induction of dormant buds and seeds.
Molecular Formula:
C15H20O4
InChI: InChI=1/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7-/t15-/m1/s1/f/h17H
InChIKey: InChIKey=JLIDBLDQVAYHNE-MPLKMVHTDC
SMILES: CC(\C=C\[C@@]1(O)C(C)=CC(=O)CC1(C)C)=C\C(O)=O
Names:
Abscisate
Abscisic acid
(+)-Abscisic acid
(+)-abscisic acid
(2Z,4E)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxo-1-cyclohex-2-enyl]-3-methyl-penta-2,4-dienoic acid
(7E,9Z)-(6S)-6-hydroxy-3-oxo-11-apo-ε-caroten-11-oic acid
Registries:
PubChem CID 5280896
ChEBI 2365
Kegg C06082
PubChem ID 15095208
PubChem ID 8348
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|